C30H52O8 — CID 174806895
butyl prop-2-enoate;3-methylbutyl prop-2-enoate;2-methylpropyl prop-2-enoate;pentyl prop-2-enoate (PubChem CID 174806895) has the molecular formula C30H52O8 and a molecular weight of 540.74 g/mol. Its IUPAC name is butyl prop-2-enoate;3-methylbutyl prop-2-enoate;2-methylpropyl prop-2-enoate;pentyl prop-2-enoate.
| Compound Name | butyl prop-2-enoate;3-methylbutyl prop-2-enoate;2-methylpropyl prop-2-enoate;pentyl prop-2-enoate |
|---|---|
| PubChem CID | 174806895 |
| Molecular Formula | C30H52O8 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | butyl prop-2-enoate;3-methylbutyl prop-2-enoate;2-methylpropyl prop-2-enoate;pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)C.C=CC(=O)OCCC(C)C.C=CC(=O)OCCCC.C=CC(=O)OCCCCC |
| InChI | InChI=1S/2C8H14O2.2C7H12O2/c1-4-8(9)10-6-5-7(2)3;1-3-5-6-7-10-8(9)4-2;1-4-7(8)9-5-6(2)3;1-3-5-6-9-7(8)4-2/h4,7H,1,5-6H2,2-3H3;4H,2-3,5-7H2,1H3;4,6H,1,5H2,2-3H3;4H,2-3,5-6H2,1H3 |
| InChIKey | DUYFRKQMPUCGTI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|