About 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol
4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol (PubChem CID 174807108) has the molecular formula C30H38O3
and a molecular weight of 446.63 g/mol. Its IUPAC name is 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol.
Molecular Properties
| Compound Name | 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol |
| PubChem CID | 174807108 |
| Molecular Formula | C30H38O3 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol |
| SMILES | CCCC(CC(c1ccc(O)c(CC)c1)c1ccc(O)c(CC)c1)c1ccc(O)c(CC)c1 |
| InChI | InChI=1S/C30H38O3/c1-5-9-23(24-10-13-28(31)20(6-2)16-24)19-27(25-11-14-29(32)21(7-3)17-25)26-12-15-30(33)22(8-4)18-26/h10-18,23,27,31-33H,5-9,19H2,1-4H3 |
| InChIKey | FPZQGSYGPUXAKO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol?
The IUPAC name of 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol (CID 174807108) is 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol.
What is the SMILES notation for 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol?
The canonical SMILES for 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol is CCCC(CC(c1ccc(O)c(CC)c1)c1ccc(O)c(CC)c1)c1ccc(O)c(CC)c1.
What is the InChIKey of 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol?
The InChIKey is FPZQGSYGPUXAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H38O3/c1-5-9-23(24-10-13-28(31)20(6-2)16-24)19-27(25-11-14-29(32)21(7-3)17-25)26-12-15-30(33)22(8-4)18-26/h10-18,23,27,31-33H,5-9,19H2,1-4H3.
What are the key properties of 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol?
4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol has a molecular weight of 446.63 g/mol, XLogP of 7.60, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,1-bis(3-ethyl-4-hydroxyphenyl)hexan-3-yl]-2-ethylphenol is sourced from PubChem (CID 174807108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).