C6H13FSi — CID 174807458
buta-1,3-dienyl(dimethyl)silane;hydrofluoride (PubChem CID 174807458) has the molecular formula C6H13FSi and a molecular weight of 132.25 g/mol. Its IUPAC name is buta-1,3-dienyl(dimethyl)silane;hydrofluoride.
| Compound Name | buta-1,3-dienyl(dimethyl)silane;hydrofluoride |
|---|---|
| PubChem CID | 174807458 |
| Molecular Formula | C6H13FSi |
| Molecular Weight | 132.25 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | buta-1,3-dienyl(dimethyl)silane;hydrofluoride |
| SMILES | C=CC=C[SiH](C)C.F |
| InChI | InChI=1S/C6H12Si.FH/c1-4-5-6-7(2)3;/h4-7H,1H2,2-3H3;1H |
| InChIKey | ZHYYEUHUWFFSLU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|