About but-1-yne;1-fluoro-2-methylbenzene
but-1-yne;1-fluoro-2-methylbenzene (PubChem CID 174807664) has the molecular formula C11H13F
and a molecular weight of 164.22 g/mol. Its IUPAC name is but-1-yne;1-fluoro-2-methylbenzene.
Molecular Properties
| Compound Name | but-1-yne;1-fluoro-2-methylbenzene |
| PubChem CID | 174807664 |
| Molecular Formula | C11H13F |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | but-1-yne;1-fluoro-2-methylbenzene |
| SMILES | C#CCC.Cc1ccccc1F |
| InChI | InChI=1S/C7H7F.C4H6/c1-6-4-2-3-5-7(6)8;1-3-4-2/h2-5H,1H3;1H,4H2,2H3 |
| InChIKey | VCWYQCZFWFFEAV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-yne;1-fluoro-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-yne;1-fluoro-2-methylbenzene?
The IUPAC name of but-1-yne;1-fluoro-2-methylbenzene (CID 174807664) is but-1-yne;1-fluoro-2-methylbenzene.
What is the SMILES notation for but-1-yne;1-fluoro-2-methylbenzene?
The canonical SMILES for but-1-yne;1-fluoro-2-methylbenzene is C#CCC.Cc1ccccc1F.
What is the InChIKey of but-1-yne;1-fluoro-2-methylbenzene?
The InChIKey is VCWYQCZFWFFEAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C4H6/c1-6-4-2-3-5-7(6)8;1-3-4-2/h2-5H,1H3;1H,4H2,2H3.
What are the key properties of but-1-yne;1-fluoro-2-methylbenzene?
but-1-yne;1-fluoro-2-methylbenzene has a molecular weight of 164.22 g/mol, XLogP of 3.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-yne;1-fluoro-2-methylbenzene is sourced from PubChem (CID 174807664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).