About ethanol;1-(2-ethylphenyl)ethanol
ethanol;1-(2-ethylphenyl)ethanol (PubChem CID 174807968) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is ethanol;1-(2-ethylphenyl)ethanol.
Molecular Properties
| Compound Name | ethanol;1-(2-ethylphenyl)ethanol |
| PubChem CID | 174807968 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | ethanol;1-(2-ethylphenyl)ethanol |
| SMILES | CCO.CCc1ccccc1C(C)O |
| InChI | InChI=1S/C10H14O.C2H6O/c1-3-9-6-4-5-7-10(9)8(2)11;1-2-3/h4-8,11H,3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | RUASTAOZDJJCAZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;1-(2-ethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-(2-ethylphenyl)ethanol?
The IUPAC name of ethanol;1-(2-ethylphenyl)ethanol (CID 174807968) is ethanol;1-(2-ethylphenyl)ethanol.
What is the SMILES notation for ethanol;1-(2-ethylphenyl)ethanol?
The canonical SMILES for ethanol;1-(2-ethylphenyl)ethanol is CCO.CCc1ccccc1C(C)O.
What is the InChIKey of ethanol;1-(2-ethylphenyl)ethanol?
The InChIKey is RUASTAOZDJJCAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C2H6O/c1-3-9-6-4-5-7-10(9)8(2)11;1-2-3/h4-8,11H,3H2,1-2H3;3H,2H2,1H3.
What are the key properties of ethanol;1-(2-ethylphenyl)ethanol?
ethanol;1-(2-ethylphenyl)ethanol has a molecular weight of 196.29 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-(2-ethylphenyl)ethanol is sourced from PubChem (CID 174807968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).