C16H19NO2 — CID 174808423
4-(1H-indol-2-yl)butanoic acid;1-methylcyclopropene (PubChem CID 174808423) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-(1H-indol-2-yl)butanoic acid;1-methylcyclopropene.
| Compound Name | 4-(1H-indol-2-yl)butanoic acid;1-methylcyclopropene |
|---|---|
| PubChem CID | 174808423 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-(1H-indol-2-yl)butanoic acid;1-methylcyclopropene |
| SMILES | CC1=CC1.O=C(O)CCCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H13NO2.C4H6/c14-12(15)7-3-5-10-8-9-4-1-2-6-11(9)13-10;1-4-2-3-4/h1-2,4,6,8,13H,3,5,7H2,(H,14,15);2H,3H2,1H3 |
| InChIKey | OZHMATDVXWPRTD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|