C6H2Br2N2O2 — CID 174808444
2,3-dibromo-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 174808444) has the molecular formula C6H2Br2N2O2 and a molecular weight of 293.90 g/mol. Its IUPAC name is 2,3-dibromo-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | 2,3-dibromo-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 174808444 |
| Molecular Formula | C6H2Br2N2O2 |
| Molecular Weight | 293.90 g/mol |
| Exact Mass | 291.85 |
| IUPAC Name | 2,3-dibromo-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | O=C1Nc2c([nH]c(Br)c2Br)C1=O |
| InChI | InChI=1S/C6H2Br2N2O2/c7-1-2-3(9-5(1)8)4(11)6(12)10-2/h9H,(H,10,11,12) |
| InChIKey | WIOSBPFEAZHPQP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.90 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|