About [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea
[(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea (PubChem CID 174808647) has the molecular formula C9H14N2S
and a molecular weight of 182.29 g/mol. Its IUPAC name is [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea.
Molecular Properties
| Compound Name | [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea |
| PubChem CID | 174808647 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea |
| SMILES | CC[C@@]1(NC(N)=S)C=CC=CC1 |
| InChI | InChI=1S/C9H14N2S/c1-2-9(11-8(10)12)6-4-3-5-7-9/h3-6H,2,7H2,1H3,(H3,10,11,12)/t9-/m1/s1 |
| InChIKey | BTSABAMFYFFPOF-SECBINFHSA-N |
| XLogP | 1.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea?
The IUPAC name of [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea (CID 174808647) is [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea.
What is the SMILES notation for [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea?
The canonical SMILES for [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea is CC[C@@]1(NC(N)=S)C=CC=CC1.
What is the InChIKey of [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea?
The InChIKey is BTSABAMFYFFPOF-SECBINFHSA-N. The full InChI is InChI=1S/C9H14N2S/c1-2-9(11-8(10)12)6-4-3-5-7-9/h3-6H,2,7H2,1H3,(H3,10,11,12)/t9-/m1/s1.
What are the key properties of [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea?
[(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea has a molecular weight of 182.29 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]thiourea is sourced from PubChem (CID 174808647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).