About methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate
methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate (PubChem CID 174809388) has the molecular formula C23H30O7
and a molecular weight of 418.49 g/mol. Its IUPAC name is methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate.
Molecular Properties
| Compound Name | methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate |
| PubChem CID | 174809388 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(=C)CC(OC1=CCCC1)OC1=CCCC1.C=CC(=O)OC |
| InChI | InChI=1S/C19H24O5.C4H6O2/c1-13(2)18(20)24-19(21)14(3)12-17(22-15-8-4-5-9-15)23-16-10-6-7-11-16;1-3-4(5)6-2/h8,10,17H,1,3-7,9,11-12H2,2H3;3H,1H2,2H3 |
| InChIKey | ZVGGVTUIYIIFOO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate?
The IUPAC name of methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate (CID 174809388) is methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate.
What is the SMILES notation for methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate?
The canonical SMILES for methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate is C=C(C)C(=O)OC(=O)C(=C)CC(OC1=CCCC1)OC1=CCCC1.C=CC(=O)OC.
What is the InChIKey of methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate?
The InChIKey is ZVGGVTUIYIIFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O5.C4H6O2/c1-13(2)18(20)24-19(21)14(3)12-17(22-15-8-4-5-9-15)23-16-10-6-7-11-16;1-3-4(5)6-2/h8,10,17H,1,3-7,9,11-12H2,2H3;3H,1H2,2H3.
What are the key properties of methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate?
methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate has a molecular weight of 418.49 g/mol, XLogP of 4.42, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl prop-2-enoate;2-methylprop-2-enoyl 4,4-di(cyclopenten-1-yloxy)-2-methylidenebutanoate is sourced from PubChem (CID 174809388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).