About bromobenzene;chromen-4-one
bromobenzene;chromen-4-one (PubChem CID 174809663) has the molecular formula C15H11BrO2
and a molecular weight of 303.16 g/mol. Its IUPAC name is bromobenzene;chromen-4-one.
Molecular Properties
| Compound Name | bromobenzene;chromen-4-one |
| PubChem CID | 174809663 |
| Molecular Formula | C15H11BrO2 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | bromobenzene;chromen-4-one |
| SMILES | Brc1ccccc1.O=c1ccoc2ccccc12 |
| InChI | InChI=1S/C9H6O2.C6H5Br/c10-8-5-6-11-9-4-2-1-3-7(8)9;7-6-4-2-1-3-5-6/h1-6H;1-5H |
| InChIKey | FGTFFEZUZGOJFH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bromobenzene;chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;chromen-4-one?
The IUPAC name of bromobenzene;chromen-4-one (CID 174809663) is bromobenzene;chromen-4-one.
What is the SMILES notation for bromobenzene;chromen-4-one?
The canonical SMILES for bromobenzene;chromen-4-one is Brc1ccccc1.O=c1ccoc2ccccc12.
What is the InChIKey of bromobenzene;chromen-4-one?
The InChIKey is FGTFFEZUZGOJFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C6H5Br/c10-8-5-6-11-9-4-2-1-3-7(8)9;7-6-4-2-1-3-5-6/h1-6H;1-5H.
What are the key properties of bromobenzene;chromen-4-one?
bromobenzene;chromen-4-one has a molecular weight of 303.16 g/mol, XLogP of 4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;chromen-4-one is sourced from PubChem (CID 174809663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).