C20H19ClN4O4 — CID 174810771
tert-butyl N-[6-chloro-3-nitro-2-(quinolin-6-ylmethyl)-4-pyridinyl]carbamate (PubChem CID 174810771) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-3-nitro-2-(quinolin-6-ylmethyl)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-chloro-3-nitro-2-(quinolin-6-ylmethyl)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 174810771 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | tert-butyl N-[6-chloro-3-nitro-2-(quinolin-6-ylmethyl)-4-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)nc(Cc2ccc3ncccc3c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19ClN4O4/c1-20(2,3)29-19(26)24-16-11-17(21)23-15(18(16)25(27)28)10-12-6-7-14-13(9-12)5-4-8-22-14/h4-9,11H,10H2,1-3H3,(H,23,24,26) |
| InChIKey | NPMOIVRCJMSPCV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|