C17H18F3N5O3 — CID 174811032
N'-propanoyl-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyrazine-2-carbohydrazide (PubChem CID 174811032) has the molecular formula C17H18F3N5O3 and a molecular weight of 397.36 g/mol. Its IUPAC name is N'-propanoyl-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-propanoyl-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 174811032 |
| Molecular Formula | C17H18F3N5O3 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N'-propanoyl-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyrazine-2-carbohydrazide |
| SMILES | CCC(=O)NN(C(=O)c1cnccn1)C(C)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C17H18F3N5O3/c1-3-14(26)24-25(16(27)13-9-21-6-7-22-13)11(2)12-4-5-15(23-8-12)28-10-17(18,19)20/h4-9,11H,3,10H2,1-2H3,(H,24,26) |
| InChIKey | YNAATHGUXLMIPV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|