About N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide
N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide (PubChem CID 174811154) has the molecular formula C16H19F3N4O2
and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide.
Molecular Properties
| Compound Name | N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide |
| PubChem CID | 174811154 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide |
| SMILES | CCC(=O)NC1(NCc2ccc(OCC(F)F)c(F)c2)C=NC=CN1 |
| InChI | InChI=1S/C16H19F3N4O2/c1-2-15(24)23-16(10-20-5-6-21-16)22-8-11-3-4-13(12(17)7-11)25-9-14(18)19/h3-7,10,14,21-22H,2,8-9H2,1H3,(H,23,24) |
| InChIKey | UAHQCEMFLCVODN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide?
The IUPAC name of N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide (CID 174811154) is N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide.
What is the SMILES notation for N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide?
The canonical SMILES for N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide is CCC(=O)NC1(NCc2ccc(OCC(F)F)c(F)c2)C=NC=CN1.
What is the InChIKey of N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide?
The InChIKey is UAHQCEMFLCVODN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3N4O2/c1-2-15(24)23-16(10-20-5-6-21-16)22-8-11-3-4-13(12(17)7-11)25-9-14(18)19/h3-7,10,14,21-22H,2,8-9H2,1H3,(H,23,24).
What are the key properties of N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide?
N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide has a molecular weight of 356.35 g/mol, XLogP of 1.88, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[4-(2,2-difluoroethoxy)-3-fluorophenyl]methylamino]-1H-pyrazin-2-yl]propanamide is sourced from PubChem (CID 174811154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).