C14H22ClN5O7 — CID 174811777
2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine;2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 174811777) has the molecular formula C14H22ClN5O7 and a molecular weight of 407.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine;2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine;2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 174811777 |
| Molecular Formula | C14H22ClN5O7 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine;2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | NC(N)=N/C(N)=N/c1ccc(Cl)cc1.O=C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H10ClN5.C6H12O7/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11;7-1-2(8)3(9)4(10)5(11)6(12)13/h1-4H,(H6,10,11,12,13,14);2-5,7-11H,1H2,(H,12,13) |
| InChIKey | XDWLWUMEXGGYQA-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 241.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|