About tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline
tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline (PubChem CID 174811866) has the molecular formula C20H35N5O3
and a molecular weight of 393.53 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline.
Molecular Properties
| Compound Name | tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline |
| PubChem CID | 174811866 |
| Molecular Formula | C20H35N5O3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.CO[C@H]1CN(c2ccc(N)cc2)CCN1 |
| InChI | InChI=1S/C11H17N3O.C9H18N2O2/c1-15-11-8-14(7-6-13-11)10-4-2-9(12)3-5-10;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h2-5,11,13H,6-8,12H2,1H3;10H,4-7H2,1-3H3/t11-;/m0./s1 |
| InChIKey | BCRBBTSGFCSOOZ-MERQFXBCSA-N |
| XLogP | 1.48 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline?
The IUPAC name of tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline (CID 174811866) is tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline.
What is the SMILES notation for tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline?
The canonical SMILES for tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline is CC(C)(C)OC(=O)N1CCNCC1.CO[C@H]1CN(c2ccc(N)cc2)CCN1.
What is the InChIKey of tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline?
The InChIKey is BCRBBTSGFCSOOZ-MERQFXBCSA-N. The full InChI is InChI=1S/C11H17N3O.C9H18N2O2/c1-15-11-8-14(7-6-13-11)10-4-2-9(12)3-5-10;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h2-5,11,13H,6-8,12H2,1H3;10H,4-7H2,1-3H3/t11-;/m0./s1.
What are the key properties of tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline?
tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline has a molecular weight of 393.53 g/mol, XLogP of 1.48, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl piperazine-1-carboxylate;4-[(3S)-3-methoxypiperazin-1-yl]aniline is sourced from PubChem (CID 174811866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).