C26H26BrCl2F3N6O3 — CID 174811875
4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carbonitrile;(E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 174811875) has the molecular formula C26H26BrCl2F3N6O3 and a molecular weight of 678.34 g/mol. Its IUPAC name is 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carbonitrile;(E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine.
| Compound Name | 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carbonitrile;(E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 174811875 |
| Molecular Formula | C26H26BrCl2F3N6O3 |
| Molecular Weight | 678.34 g/mol |
| Exact Mass | 676.06 |
| IUPAC Name | 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carbonitrile;(E)-1-N'-[(6-chloro-3-pyridinyl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CCN(Cc1ccc(Cl)nc1)/C(=C/[N+](=O)[O-])NC.CCOCn1c(-c2ccc(Cl)cc2)c(C#N)c(Br)c1C(F)(F)F |
| InChI | InChI=1S/C15H11BrClF3N2O.C11H15ClN4O2/c1-2-23-8-22-13(9-3-5-10(17)6-4-9)11(7-21)12(16)14(22)15(18,19)20;1-3-15(11(13-2)8-16(17)18)7-9-4-5-10(12)14-6-9/h3-6H,2,8H2,1H3;4-6,8,13H,3,7H2,1-2H3/b;11-8+ |
| InChIKey | HEULFPLRYQVHCX-IBMQDACXSA-N |
| XLogP | 7.31 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.34 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|