C13H14O5 — CID 174811983
1-(cyclopropanecarbonyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174811983) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-(cyclopropanecarbonyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174811983 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1C(C(=O)O)=CC=CC1(C(=O)O)C(=O)C1CC1 |
| InChI | InChI=1S/C13H14O5/c1-7-9(11(15)16)3-2-6-13(7,12(17)18)10(14)8-4-5-8/h2-3,6-8H,4-5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | OQYVBZAMLKJIRR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|