About 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene
1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene (PubChem CID 174812283) has the molecular formula C18H19F3
and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene |
| PubChem CID | 174812283 |
| Molecular Formula | C18H19F3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene |
| SMILES | Fc1cccc(F)c1.Fc1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C12H15F.C6H4F2/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;7-5-2-1-3-6(8)4-5/h4-5,8-10H,1-3,6-7H2;1-4H |
| InChIKey | FGYLXSJXINFGFA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene?
The IUPAC name of 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene (CID 174812283) is 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene.
What is the SMILES notation for 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene?
The canonical SMILES for 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene is Fc1cccc(F)c1.Fc1ccccc1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene?
The InChIKey is FGYLXSJXINFGFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F.C6H4F2/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;7-5-2-1-3-6(8)4-5/h4-5,8-10H,1-3,6-7H2;1-4H.
What are the key properties of 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene?
1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene has a molecular weight of 292.34 g/mol, XLogP of 5.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-fluorobenzene;1,3-difluorobenzene is sourced from PubChem (CID 174812283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).