About 2-ethoxypropylideneurea
2-ethoxypropylideneurea (PubChem CID 174812399) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-ethoxypropylideneurea.
Molecular Properties
| Compound Name | 2-ethoxypropylideneurea |
| PubChem CID | 174812399 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-ethoxypropylideneurea |
| SMILES | CCOC(C)C=NC(N)=O |
| InChI | InChI=1S/C6H12N2O2/c1-3-10-5(2)4-8-6(7)9/h4-5H,3H2,1-2H3,(H2,7,9) |
| InChIKey | PTDLQPKDPNXSRR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxypropylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypropylideneurea?
The IUPAC name of 2-ethoxypropylideneurea (CID 174812399) is 2-ethoxypropylideneurea.
What is the SMILES notation for 2-ethoxypropylideneurea?
The canonical SMILES for 2-ethoxypropylideneurea is CCOC(C)C=NC(N)=O.
What is the InChIKey of 2-ethoxypropylideneurea?
The InChIKey is PTDLQPKDPNXSRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-3-10-5(2)4-8-6(7)9/h4-5H,3H2,1-2H3,(H2,7,9).
What are the key properties of 2-ethoxypropylideneurea?
2-ethoxypropylideneurea has a molecular weight of 144.17 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypropylideneurea is sourced from PubChem (CID 174812399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).