About 3,3-diethylcyclopentan-1-amine;methanol
3,3-diethylcyclopentan-1-amine;methanol (PubChem CID 174812528) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is 3,3-diethylcyclopentan-1-amine;methanol.
Molecular Properties
| Compound Name | 3,3-diethylcyclopentan-1-amine;methanol |
| PubChem CID | 174812528 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 3,3-diethylcyclopentan-1-amine;methanol |
| SMILES | CCC1(CC)CCC(N)C1.CO |
| InChI | InChI=1S/C9H19N.CH4O/c1-3-9(4-2)6-5-8(10)7-9;1-2/h8H,3-7,10H2,1-2H3;2H,1H3 |
| InChIKey | PTSSWUNKLVHXAR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-diethylcyclopentan-1-amine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethylcyclopentan-1-amine;methanol?
The IUPAC name of 3,3-diethylcyclopentan-1-amine;methanol (CID 174812528) is 3,3-diethylcyclopentan-1-amine;methanol.
What is the SMILES notation for 3,3-diethylcyclopentan-1-amine;methanol?
The canonical SMILES for 3,3-diethylcyclopentan-1-amine;methanol is CCC1(CC)CCC(N)C1.CO.
What is the InChIKey of 3,3-diethylcyclopentan-1-amine;methanol?
The InChIKey is PTSSWUNKLVHXAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.CH4O/c1-3-9(4-2)6-5-8(10)7-9;1-2/h8H,3-7,10H2,1-2H3;2H,1H3.
What are the key properties of 3,3-diethylcyclopentan-1-amine;methanol?
3,3-diethylcyclopentan-1-amine;methanol has a molecular weight of 173.30 g/mol, XLogP of 1.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethylcyclopentan-1-amine;methanol is sourced from PubChem (CID 174812528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).