About S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate
S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate (PubChem CID 174812578) has the molecular formula C14H11F3OS
and a molecular weight of 284.30 g/mol. Its IUPAC name is S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate.
Molecular Properties
| Compound Name | S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate |
| PubChem CID | 174812578 |
| Molecular Formula | C14H11F3OS |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate |
| SMILES | O=C(SC(F)(F)F)C1(c2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C14H11F3OS/c15-14(16,17)19-12(18)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1-9H,10H2 |
| InChIKey | SLHHWJIEJBMVBK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate?
The IUPAC name of S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate (CID 174812578) is S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate.
What is the SMILES notation for S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate?
The canonical SMILES for S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate is O=C(SC(F)(F)F)C1(c2ccccc2)C=CC=CC1.
What is the InChIKey of S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate?
The InChIKey is SLHHWJIEJBMVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3OS/c15-14(16,17)19-12(18)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1-9H,10H2.
What are the key properties of S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate?
S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate has a molecular weight of 284.30 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(trifluoromethyl) 1-phenylcyclohexa-2,4-diene-1-carbothioate is sourced from PubChem (CID 174812578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).