C23H14O10 — CID 174813174
2-[3-carboxy-2-(2,5-dicarboxyphenyl)phenyl]terephthalic acid (PubChem CID 174813174) has the molecular formula C23H14O10 and a molecular weight of 450.36 g/mol. Its IUPAC name is 2-[3-carboxy-2-(2,5-dicarboxyphenyl)phenyl]terephthalic acid.
| Compound Name | 2-[3-carboxy-2-(2,5-dicarboxyphenyl)phenyl]terephthalic acid |
|---|---|
| PubChem CID | 174813174 |
| Molecular Formula | C23H14O10 |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-[3-carboxy-2-(2,5-dicarboxyphenyl)phenyl]terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(-c2cccc(C(=O)O)c2-c2cc(C(=O)O)ccc2C(=O)O)c1 |
| InChI | InChI=1S/C23H14O10/c24-19(25)10-4-6-13(21(28)29)16(8-10)12-2-1-3-15(23(32)33)18(12)17-9-11(20(26)27)5-7-14(17)22(30)31/h1-9H,(H,24,25)(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | HCYQDSOYJAYTKJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |