About triethoxy (2-methylpropan-2-yl)oxy silicate
triethoxy (2-methylpropan-2-yl)oxy silicate (PubChem CID 174813265) has the molecular formula C10H24O8Si
and a molecular weight of 300.38 g/mol. Its IUPAC name is triethoxy (2-methylpropan-2-yl)oxy silicate.
Molecular Properties
| Compound Name | triethoxy (2-methylpropan-2-yl)oxy silicate |
| PubChem CID | 174813265 |
| Molecular Formula | C10H24O8Si |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | triethoxy (2-methylpropan-2-yl)oxy silicate |
| SMILES | CCOO[Si](OOCC)(OOCC)OOC(C)(C)C |
| InChI | InChI=1S/C10H24O8Si/c1-7-11-15-19(16-12-8-2,17-13-9-3)18-14-10(4,5)6/h7-9H2,1-6H3 |
| InChIKey | SNGXFNOTRKPYEU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze triethoxy (2-methylpropan-2-yl)oxy silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy (2-methylpropan-2-yl)oxy silicate?
The IUPAC name of triethoxy (2-methylpropan-2-yl)oxy silicate (CID 174813265) is triethoxy (2-methylpropan-2-yl)oxy silicate.
What is the SMILES notation for triethoxy (2-methylpropan-2-yl)oxy silicate?
The canonical SMILES for triethoxy (2-methylpropan-2-yl)oxy silicate is CCOO[Si](OOCC)(OOCC)OOC(C)(C)C.
What is the InChIKey of triethoxy (2-methylpropan-2-yl)oxy silicate?
The InChIKey is SNGXFNOTRKPYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24O8Si/c1-7-11-15-19(16-12-8-2,17-13-9-3)18-14-10(4,5)6/h7-9H2,1-6H3.
What are the key properties of triethoxy (2-methylpropan-2-yl)oxy silicate?
triethoxy (2-methylpropan-2-yl)oxy silicate has a molecular weight of 300.38 g/mol, XLogP of 2.07, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy (2-methylpropan-2-yl)oxy silicate is sourced from PubChem (CID 174813265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).