About nitroso 2-cyanoacetate
nitroso 2-cyanoacetate (PubChem CID 174813457) has the molecular formula C3H2N2O3
and a molecular weight of 114.06 g/mol. Its IUPAC name is nitroso 2-cyanoacetate.
Molecular Properties
| Compound Name | nitroso 2-cyanoacetate |
| PubChem CID | 174813457 |
| Molecular Formula | C3H2N2O3 |
| Molecular Weight | 114.06 g/mol |
| Exact Mass | 114.01 |
| IUPAC Name | nitroso 2-cyanoacetate |
| SMILES | N#CCC(=O)ON=O |
| InChI | InChI=1S/C3H2N2O3/c4-2-1-3(6)8-5-7/h1H2 |
| InChIKey | PRAXRYYKOBENBF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.06 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitroso 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitroso 2-cyanoacetate?
The IUPAC name of nitroso 2-cyanoacetate (CID 174813457) is nitroso 2-cyanoacetate.
What is the SMILES notation for nitroso 2-cyanoacetate?
The canonical SMILES for nitroso 2-cyanoacetate is N#CCC(=O)ON=O.
What is the InChIKey of nitroso 2-cyanoacetate?
The InChIKey is PRAXRYYKOBENBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N2O3/c4-2-1-3(6)8-5-7/h1H2.
What are the key properties of nitroso 2-cyanoacetate?
nitroso 2-cyanoacetate has a molecular weight of 114.06 g/mol, XLogP of 0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitroso 2-cyanoacetate is sourced from PubChem (CID 174813457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).