About N-carbamoylformamide;hydrate
N-carbamoylformamide;hydrate (PubChem CID 174813959) has the molecular formula C2H6N2O3
and a molecular weight of 106.08 g/mol. Its IUPAC name is N-carbamoylformamide;hydrate.
Molecular Properties
| Compound Name | N-carbamoylformamide;hydrate |
| PubChem CID | 174813959 |
| Molecular Formula | C2H6N2O3 |
| Molecular Weight | 106.08 g/mol |
| Exact Mass | 106.04 |
| IUPAC Name | N-carbamoylformamide;hydrate |
| SMILES | NC(=O)NC=O.O |
| InChI | InChI=1S/C2H4N2O2.H2O/c3-2(6)4-1-5;/h1H,(H3,3,4,5,6);1H2 |
| InChIKey | OFWWRMHTTHWXMN-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.08 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-carbamoylformamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoylformamide;hydrate?
The IUPAC name of N-carbamoylformamide;hydrate (CID 174813959) is N-carbamoylformamide;hydrate.
What is the SMILES notation for N-carbamoylformamide;hydrate?
The canonical SMILES for N-carbamoylformamide;hydrate is NC(=O)NC=O.O.
What is the InChIKey of N-carbamoylformamide;hydrate?
The InChIKey is OFWWRMHTTHWXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N2O2.H2O/c3-2(6)4-1-5;/h1H,(H3,3,4,5,6);1H2.
What are the key properties of N-carbamoylformamide;hydrate?
N-carbamoylformamide;hydrate has a molecular weight of 106.08 g/mol, XLogP of -2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoylformamide;hydrate is sourced from PubChem (CID 174813959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).