C10H22O5S — CID 174813976
ethylsulfanylethane;2,3,4,5-tetrahydroxyhexanal (PubChem CID 174813976) has the molecular formula C10H22O5S and a molecular weight of 254.35 g/mol. Its IUPAC name is ethylsulfanylethane;2,3,4,5-tetrahydroxyhexanal.
| Compound Name | ethylsulfanylethane;2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 174813976 |
| Molecular Formula | C10H22O5S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethylsulfanylethane;2,3,4,5-tetrahydroxyhexanal |
| SMILES | CC(O)C(O)C(O)C(O)C=O.CCSCC |
| InChI | InChI=1S/C6H12O5.C4H10S/c1-3(8)5(10)6(11)4(9)2-7;1-3-5-4-2/h2-6,8-11H,1H3;3-4H2,1-2H3 |
| InChIKey | QSHLHHLKNVTBEY-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|