About 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile
5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile (PubChem CID 174814217) has the molecular formula C17H11Br2ClN4O2
and a molecular weight of 498.56 g/mol. Its IUPAC name is 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile.
Molecular Properties
| Compound Name | 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile |
| PubChem CID | 174814217 |
| Molecular Formula | C17H11Br2ClN4O2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 495.89 |
| IUPAC Name | 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile |
| SMILES | N#Cc1cc(Br)c(O)c(Br)c1.Nc1cnn(-c2ccccc2)c(=O)c1Cl |
| InChI | InChI=1S/C10H8ClN3O.C7H3Br2NO/c11-9-8(12)6-13-14(10(9)15)7-4-2-1-3-5-7;8-5-1-4(3-10)2-6(9)7(5)11/h1-6H,12H2;1-2,11H |
| InChIKey | WWJBTMJFWGBROW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile?
The IUPAC name of 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile (CID 174814217) is 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile.
What is the SMILES notation for 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile?
The canonical SMILES for 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile is N#Cc1cc(Br)c(O)c(Br)c1.Nc1cnn(-c2ccccc2)c(=O)c1Cl.
What is the InChIKey of 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile?
The InChIKey is WWJBTMJFWGBROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3O.C7H3Br2NO/c11-9-8(12)6-13-14(10(9)15)7-4-2-1-3-5-7;8-5-1-4(3-10)2-6(9)7(5)11/h1-6H,12H2;1-2,11H.
What are the key properties of 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile?
5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile has a molecular weight of 498.56 g/mol, XLogP of 4.26, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-chloro-2-phenylpyridazin-3-one;3,5-dibromo-4-hydroxybenzonitrile is sourced from PubChem (CID 174814217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).