About diethoxy(dimethyl)silane;piperazine
diethoxy(dimethyl)silane;piperazine (PubChem CID 174814266) has the molecular formula C10H26N2O2Si
and a molecular weight of 234.42 g/mol. Its IUPAC name is diethoxy(dimethyl)silane;piperazine.
Molecular Properties
| Compound Name | diethoxy(dimethyl)silane;piperazine |
| PubChem CID | 174814266 |
| Molecular Formula | C10H26N2O2Si |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | diethoxy(dimethyl)silane;piperazine |
| SMILES | C1CNCCN1.CCO[Si](C)(C)OCC |
| InChI | InChI=1S/C6H16O2Si.C4H10N2/c1-5-7-9(3,4)8-6-2;1-2-6-4-3-5-1/h5-6H2,1-4H3;5-6H,1-4H2 |
| InChIKey | CEIVCLRSWMKLED-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(dimethyl)silane;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(dimethyl)silane;piperazine?
The IUPAC name of diethoxy(dimethyl)silane;piperazine (CID 174814266) is diethoxy(dimethyl)silane;piperazine.
What is the SMILES notation for diethoxy(dimethyl)silane;piperazine?
The canonical SMILES for diethoxy(dimethyl)silane;piperazine is C1CNCCN1.CCO[Si](C)(C)OCC.
What is the InChIKey of diethoxy(dimethyl)silane;piperazine?
The InChIKey is CEIVCLRSWMKLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O2Si.C4H10N2/c1-5-7-9(3,4)8-6-2;1-2-6-4-3-5-1/h5-6H2,1-4H3;5-6H,1-4H2.
What are the key properties of diethoxy(dimethyl)silane;piperazine?
diethoxy(dimethyl)silane;piperazine has a molecular weight of 234.42 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(dimethyl)silane;piperazine is sourced from PubChem (CID 174814266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).