C43H44F2N4O — CID 174814527
1,5-bis(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-2,4-bis(4-fluorophenyl)pentan-3-one (PubChem CID 174814527) has the molecular formula C43H44F2N4O and a molecular weight of 670.85 g/mol. Its IUPAC name is 1,5-bis(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-2,4-bis(4-fluorophenyl)pentan-3-one.
| Compound Name | 1,5-bis(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-2,4-bis(4-fluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 174814527 |
| Molecular Formula | C43H44F2N4O |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | 1,5-bis(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-2,4-bis(4-fluorophenyl)pentan-3-one |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(C(=O)C(Cn2c3c(c4cc(C)ccc42)CN(C)CC3)c2ccc(F)cc2)c2ccc(F)cc2)CCN(C)C1 |
| InChI | InChI=1S/C43H44F2N4O/c1-27-5-15-39-33(21-27)37-23-46(3)19-17-41(37)48(39)25-35(29-7-11-31(44)12-8-29)43(50)36(30-9-13-32(45)14-10-30)26-49-40-16-6-28(2)22-34(40)38-24-47(4)20-18-42(38)49/h5-16,21-22,35-36H,17-20,23-26H2,1-4H3 |
| InChIKey | MADBNEXXLTTYDA-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 33.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|