About 1,3-dimethylpyrazole;pyridine
1,3-dimethylpyrazole;pyridine (PubChem CID 174814756) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1,3-dimethylpyrazole;pyridine.
Molecular Properties
| Compound Name | 1,3-dimethylpyrazole;pyridine |
| PubChem CID | 174814756 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1,3-dimethylpyrazole;pyridine |
| SMILES | Cc1ccn(C)n1.c1ccncc1 |
| InChI | InChI=1S/C5H8N2.C5H5N/c1-5-3-4-7(2)6-5;1-2-4-6-5-3-1/h3-4H,1-2H3;1-5H |
| InChIKey | WVAMHAJPWAQBNC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethylpyrazole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrazole;pyridine?
The IUPAC name of 1,3-dimethylpyrazole;pyridine (CID 174814756) is 1,3-dimethylpyrazole;pyridine.
What is the SMILES notation for 1,3-dimethylpyrazole;pyridine?
The canonical SMILES for 1,3-dimethylpyrazole;pyridine is Cc1ccn(C)n1.c1ccncc1.
What is the InChIKey of 1,3-dimethylpyrazole;pyridine?
The InChIKey is WVAMHAJPWAQBNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C5H5N/c1-5-3-4-7(2)6-5;1-2-4-6-5-3-1/h3-4H,1-2H3;1-5H.
What are the key properties of 1,3-dimethylpyrazole;pyridine?
1,3-dimethylpyrazole;pyridine has a molecular weight of 175.23 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrazole;pyridine is sourced from PubChem (CID 174814756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).