C17H17FN2O4 — CID 17481500
methyl 5-acetyl-2-[2-(4-fluoroanilino)-2-oxoethyl]-4-methyl-1H-pyrrole-3-carboxylate (PubChem CID 17481500) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is methyl 5-acetyl-2-[2-(4-fluoroanilino)-2-oxoethyl]-4-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-acetyl-2-[2-(4-fluoroanilino)-2-oxoethyl]-4-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 17481500 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | methyl 5-acetyl-2-[2-(4-fluoroanilino)-2-oxoethyl]-4-methyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(CC(=O)Nc2ccc(F)cc2)[nH]c(C(C)=O)c1C |
| InChI | InChI=1S/C17H17FN2O4/c1-9-15(17(23)24-3)13(20-16(9)10(2)21)8-14(22)19-12-6-4-11(18)5-7-12/h4-7,20H,8H2,1-3H3,(H,19,22) |
| InChIKey | NHFGNDNWKFRQEG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |