About methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione
methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione (PubChem CID 174815384) has the molecular formula C11H14O6
and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione.
Molecular Properties
| Compound Name | methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione |
| PubChem CID | 174815384 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione |
| SMILES | C=C(C(=O)OC)C(C)O.C=C1CC(=O)OC1=O |
| InChI | InChI=1S/C6H10O3.C5H4O3/c1-4(5(2)7)6(8)9-3;1-3-2-4(6)8-5(3)7/h5,7H,1H2,2-3H3;1-2H2 |
| InChIKey | SQOHAZGXIWBZPE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione?
The IUPAC name of methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione (CID 174815384) is methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione.
What is the SMILES notation for methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione?
The canonical SMILES for methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione is C=C(C(=O)OC)C(C)O.C=C1CC(=O)OC1=O.
What is the InChIKey of methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione?
The InChIKey is SQOHAZGXIWBZPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C5H4O3/c1-4(5(2)7)6(8)9-3;1-3-2-4(6)8-5(3)7/h5,7H,1H2,2-3H3;1-2H2.
What are the key properties of methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione?
methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione has a molecular weight of 242.23 g/mol, XLogP of 0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-2-methylidenebutanoate;3-methylideneoxolane-2,5-dione is sourced from PubChem (CID 174815384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).