C18H22N2S — CID 174815755
1-(3,5-dimethylphenyl)sulfanyl-4-phenylpiperazine (PubChem CID 174815755) has the molecular formula C18H22N2S and a molecular weight of 298.46 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)sulfanyl-4-phenylpiperazine.
| Compound Name | 1-(3,5-dimethylphenyl)sulfanyl-4-phenylpiperazine |
|---|---|
| PubChem CID | 174815755 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(3,5-dimethylphenyl)sulfanyl-4-phenylpiperazine |
| SMILES | Cc1cc(C)cc(SN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C18H22N2S/c1-15-12-16(2)14-18(13-15)21-20-10-8-19(9-11-20)17-6-4-3-5-7-17/h3-7,12-14H,8-11H2,1-2H3 |
| InChIKey | IVIPWYMWHGRAPI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|