About 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde
2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde (PubChem CID 174816226) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde.
Molecular Properties
| Compound Name | 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde |
| PubChem CID | 174816226 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde |
| SMILES | CC1CC(C(=O)C=O)NCN1C |
| InChI | InChI=1S/C8H14N2O2/c1-6-3-7(8(12)4-11)9-5-10(6)2/h4,6-7,9H,3,5H2,1-2H3 |
| InChIKey | XPYLYCXEWJTSCF-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde?
The IUPAC name of 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde (CID 174816226) is 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde.
What is the SMILES notation for 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde?
The canonical SMILES for 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde is CC1CC(C(=O)C=O)NCN1C.
What is the InChIKey of 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde?
The InChIKey is XPYLYCXEWJTSCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6-3-7(8(12)4-11)9-5-10(6)2/h4,6-7,9H,3,5H2,1-2H3.
What are the key properties of 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde?
2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde has a molecular weight of 170.21 g/mol, XLogP of -0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,6-dimethyl-1,3-diazinan-4-yl)-2-oxoacetaldehyde is sourced from PubChem (CID 174816226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).