C19H38Si — CID 174816391
1,1,2-triethyl-2-oct-2-enylsilinane (PubChem CID 174816391) has the molecular formula C19H38Si and a molecular weight of 294.60 g/mol. Its IUPAC name is 1,1,2-triethyl-2-oct-2-enylsilinane.
| Compound Name | 1,1,2-triethyl-2-oct-2-enylsilinane |
|---|---|
| PubChem CID | 174816391 |
| Molecular Formula | C19H38Si |
| Molecular Weight | 294.60 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 1,1,2-triethyl-2-oct-2-enylsilinane |
| SMILES | CCCCCC=CCC1(CC)CCCC[Si]1(CC)CC |
| InChI | InChI=1S/C19H38Si/c1-5-9-10-11-12-13-16-19(6-2)17-14-15-18-20(19,7-3)8-4/h12-13H,5-11,14-18H2,1-4H3 |
| InChIKey | ORTZDAPBIXIBIO-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.60 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|