About azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride
azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride (PubChem CID 174816672) has the molecular formula C8H19ClN2O2
and a molecular weight of 210.70 g/mol. Its IUPAC name is azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride.
Molecular Properties
| Compound Name | azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride |
| PubChem CID | 174816672 |
| Molecular Formula | C8H19ClN2O2 |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride |
| SMILES | CC1(CC2CO2)CNCCO1.Cl.N |
| InChI | InChI=1S/C8H15NO2.ClH.H3N/c1-8(4-7-5-10-7)6-9-2-3-11-8;;/h7,9H,2-6H2,1H3;1H;1H3 |
| InChIKey | IXUFCUXXTSDDFJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride?
The IUPAC name of azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride (CID 174816672) is azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride.
What is the SMILES notation for azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride?
The canonical SMILES for azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride is CC1(CC2CO2)CNCCO1.Cl.N.
What is the InChIKey of azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride?
The InChIKey is IXUFCUXXTSDDFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.ClH.H3N/c1-8(4-7-5-10-7)6-9-2-3-11-8;;/h7,9H,2-6H2,1H3;1H;1H3.
What are the key properties of azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride?
azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride has a molecular weight of 210.70 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methyl-2-(oxiran-2-ylmethyl)morpholine;hydrochloride is sourced from PubChem (CID 174816672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).