About heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride
heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride (PubChem CID 174817003) has the molecular formula C17H29ClN2O3
and a molecular weight of 344.88 g/mol. Its IUPAC name is heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride.
Molecular Properties
| Compound Name | heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride |
| PubChem CID | 174817003 |
| Molecular Formula | C17H29ClN2O3 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride |
| SMILES | CCCCCCC.Cc1cc(OC2CNC2)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C10H12N2O3.C7H16.ClH/c1-7-4-8(15-9-5-11-6-9)2-3-10(7)12(13)14;1-3-5-7-6-4-2;/h2-4,9,11H,5-6H2,1H3;3-7H2,1-2H3;1H |
| InChIKey | PVKGRRIZGIQYLY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride?
The IUPAC name of heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride (CID 174817003) is heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride.
What is the SMILES notation for heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride?
The canonical SMILES for heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride is CCCCCCC.Cc1cc(OC2CNC2)ccc1[N+](=O)[O-].Cl.
What is the InChIKey of heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride?
The InChIKey is PVKGRRIZGIQYLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3.C7H16.ClH/c1-7-4-8(15-9-5-11-6-9)2-3-10(7)12(13)14;1-3-5-7-6-4-2;/h2-4,9,11H,5-6H2,1H3;3-7H2,1-2H3;1H.
What are the key properties of heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride?
heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride has a molecular weight of 344.88 g/mol, XLogP of 4.65, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;3-(3-methyl-4-nitrophenoxy)azetidine;hydrochloride is sourced from PubChem (CID 174817003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).