About 1,1-dichloroethene;urea
1,1-dichloroethene;urea (PubChem CID 174817007) has the molecular formula C3H6Cl2N2O
and a molecular weight of 157.00 g/mol. Its IUPAC name is 1,1-dichloroethene;urea.
Molecular Properties
| Compound Name | 1,1-dichloroethene;urea |
| PubChem CID | 174817007 |
| Molecular Formula | C3H6Cl2N2O |
| Molecular Weight | 157.00 g/mol |
| Exact Mass | 155.99 |
| IUPAC Name | 1,1-dichloroethene;urea |
| SMILES | C=C(Cl)Cl.NC(N)=O |
| InChI | InChI=1S/C2H2Cl2.CH4N2O/c1-2(3)4;2-1(3)4/h1H2;(H4,2,3,4) |
| InChIKey | LSRIBJHYLZJCAV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.00 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-dichloroethene;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloroethene;urea?
The IUPAC name of 1,1-dichloroethene;urea (CID 174817007) is 1,1-dichloroethene;urea.
What is the SMILES notation for 1,1-dichloroethene;urea?
The canonical SMILES for 1,1-dichloroethene;urea is C=C(Cl)Cl.NC(N)=O.
What is the InChIKey of 1,1-dichloroethene;urea?
The InChIKey is LSRIBJHYLZJCAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2Cl2.CH4N2O/c1-2(3)4;2-1(3)4/h1H2;(H4,2,3,4).
What are the key properties of 1,1-dichloroethene;urea?
1,1-dichloroethene;urea has a molecular weight of 157.00 g/mol, XLogP of 0.96, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloroethene;urea is sourced from PubChem (CID 174817007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).