About bis(azepan-2-one);dimethylsilane
bis(azepan-2-one);dimethylsilane (PubChem CID 174817428) has the molecular formula C14H30N2O2Si
and a molecular weight of 286.49 g/mol. Its IUPAC name is bis(azepan-2-one);dimethylsilane.
Molecular Properties
| Compound Name | bis(azepan-2-one);dimethylsilane |
| PubChem CID | 174817428 |
| Molecular Formula | C14H30N2O2Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | bis(azepan-2-one);dimethylsilane |
| SMILES | C[SiH2]C.O=C1CCCCCN1.O=C1CCCCCN1 |
| InChI | InChI=1S/2C6H11NO.C2H8Si/c2*8-6-4-2-1-3-5-7-6;1-3-2/h2*1-5H2,(H,7,8);3H2,1-2H3 |
| InChIKey | OFWJCSSPUSEAJM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(azepan-2-one);dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(azepan-2-one);dimethylsilane?
The IUPAC name of bis(azepan-2-one);dimethylsilane (CID 174817428) is bis(azepan-2-one);dimethylsilane.
What is the SMILES notation for bis(azepan-2-one);dimethylsilane?
The canonical SMILES for bis(azepan-2-one);dimethylsilane is C[SiH2]C.O=C1CCCCCN1.O=C1CCCCCN1.
What is the InChIKey of bis(azepan-2-one);dimethylsilane?
The InChIKey is OFWJCSSPUSEAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11NO.C2H8Si/c2*8-6-4-2-1-3-5-7-6;1-3-2/h2*1-5H2,(H,7,8);3H2,1-2H3.
What are the key properties of bis(azepan-2-one);dimethylsilane?
bis(azepan-2-one);dimethylsilane has a molecular weight of 286.49 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(azepan-2-one);dimethylsilane is sourced from PubChem (CID 174817428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).