C16H20N2O3 — CID 174817988
ethane-1,2-diamine;2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 174817988) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethane-1,2-diamine;2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | ethane-1,2-diamine;2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 174817988 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethane-1,2-diamine;2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1cc2cc3c(C)cc(=O)oc3c(C)c2o1.NCCN |
| InChI | InChI=1S/C14H12O3.C2H8N2/c1-7-4-12(15)17-14-9(3)13-10(6-11(7)14)5-8(2)16-13;3-1-2-4/h4-6H,1-3H3;1-4H2 |
| InChIKey | DVWKIULVOWLAAQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|