About 1-benzyl-2H-fluorene
1-benzyl-2H-fluorene (PubChem CID 174817995) has the molecular formula C20H16
and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-benzyl-2H-fluorene.
Molecular Properties
| Compound Name | 1-benzyl-2H-fluorene |
| PubChem CID | 174817995 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-benzyl-2H-fluorene |
| SMILES | C1=CC2=c3ccccc3=CC2=C(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H16/c1-2-7-15(8-3-1)13-16-10-6-12-19-18-11-5-4-9-17(18)14-20(16)19/h1-9,11-12,14H,10,13H2 |
| InChIKey | UCRZIGXFHZCKLF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-benzyl-2H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2H-fluorene?
The IUPAC name of 1-benzyl-2H-fluorene (CID 174817995) is 1-benzyl-2H-fluorene.
What is the SMILES notation for 1-benzyl-2H-fluorene?
The canonical SMILES for 1-benzyl-2H-fluorene is C1=CC2=c3ccccc3=CC2=C(Cc2ccccc2)C1.
What is the InChIKey of 1-benzyl-2H-fluorene?
The InChIKey is UCRZIGXFHZCKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16/c1-2-7-15(8-3-1)13-16-10-6-12-19-18-11-5-4-9-17(18)14-20(16)19/h1-9,11-12,14H,10,13H2.
What are the key properties of 1-benzyl-2H-fluorene?
1-benzyl-2H-fluorene has a molecular weight of 256.35 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2H-fluorene is sourced from PubChem (CID 174817995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).