C26H20O4 — CID 174818259
1-(3,4-dimethoxyphenyl)-1H-chrysene-2,4-dione (PubChem CID 174818259) has the molecular formula C26H20O4 and a molecular weight of 396.44 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-1H-chrysene-2,4-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-1H-chrysene-2,4-dione |
|---|---|
| PubChem CID | 174818259 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-1H-chrysene-2,4-dione |
| SMILES | COc1ccc(C2C(=O)CC(=O)c3c2ccc2c3ccc3ccccc32)cc1OC |
| InChI | InChI=1S/C26H20O4/c1-29-23-12-8-16(13-24(23)30-2)25-20-11-10-18-17-6-4-3-5-15(17)7-9-19(18)26(20)22(28)14-21(25)27/h3-13,25H,14H2,1-2H3 |
| InChIKey | DGHVFCZQVOAQAT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|