About azane;thiadiazole-5-carboximidamide
azane;thiadiazole-5-carboximidamide (PubChem CID 174818360) has the molecular formula C3H7N5S
and a molecular weight of 145.19 g/mol. Its IUPAC name is azane;thiadiazole-5-carboximidamide.
Molecular Properties
| Compound Name | azane;thiadiazole-5-carboximidamide |
| PubChem CID | 174818360 |
| Molecular Formula | C3H7N5S |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | azane;thiadiazole-5-carboximidamide |
| SMILES | N.[H]/N=C(\N)c1cnns1 |
| InChI | InChI=1S/C3H4N4S.H3N/c4-3(5)2-1-6-7-8-2;/h1H,(H3,4,5);1H3 |
| InChIKey | OMGACORRYZADGI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze azane;thiadiazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;thiadiazole-5-carboximidamide?
The IUPAC name of azane;thiadiazole-5-carboximidamide (CID 174818360) is azane;thiadiazole-5-carboximidamide.
What is the SMILES notation for azane;thiadiazole-5-carboximidamide?
The canonical SMILES for azane;thiadiazole-5-carboximidamide is N.[H]/N=C(\N)c1cnns1.
What is the InChIKey of azane;thiadiazole-5-carboximidamide?
The InChIKey is OMGACORRYZADGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N4S.H3N/c4-3(5)2-1-6-7-8-2;/h1H,(H3,4,5);1H3.
What are the key properties of azane;thiadiazole-5-carboximidamide?
azane;thiadiazole-5-carboximidamide has a molecular weight of 145.19 g/mol, XLogP of -0.02, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;thiadiazole-5-carboximidamide is sourced from PubChem (CID 174818360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).