C20H28N2O — CID 174819320
1-[(3-methoxyphenyl)methyl]piperidine;phenylmethanamine (PubChem CID 174819320) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]piperidine;phenylmethanamine.
| Compound Name | 1-[(3-methoxyphenyl)methyl]piperidine;phenylmethanamine |
|---|---|
| PubChem CID | 174819320 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]piperidine;phenylmethanamine |
| SMILES | COc1cccc(CN2CCCCC2)c1.NCc1ccccc1 |
| InChI | InChI=1S/C13H19NO.C7H9N/c1-15-13-7-5-6-12(10-13)11-14-8-3-2-4-9-14;8-6-7-4-2-1-3-5-7/h5-7,10H,2-4,8-9,11H2,1H3;1-5H,6,8H2 |
| InChIKey | AJLCRKFBTZWOPW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |