C14H18O12 — CID 174820107
2-[2-(1-carboxyethoxy)-2-oxoethyl]-2-(2-propanoyloxyacetyl)oxybutanedioic acid (PubChem CID 174820107) has the molecular formula C14H18O12 and a molecular weight of 378.29 g/mol. Its IUPAC name is 2-[2-(1-carboxyethoxy)-2-oxoethyl]-2-(2-propanoyloxyacetyl)oxybutanedioic acid.
| Compound Name | 2-[2-(1-carboxyethoxy)-2-oxoethyl]-2-(2-propanoyloxyacetyl)oxybutanedioic acid |
|---|---|
| PubChem CID | 174820107 |
| Molecular Formula | C14H18O12 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[2-(1-carboxyethoxy)-2-oxoethyl]-2-(2-propanoyloxyacetyl)oxybutanedioic acid |
| SMILES | CCC(=O)OCC(=O)OC(CC(=O)O)(CC(=O)OC(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18O12/c1-3-9(17)24-6-11(19)26-14(13(22)23,4-8(15)16)5-10(18)25-7(2)12(20)21/h7H,3-6H2,1-2H3,(H,15,16)(H,20,21)(H,22,23) |
| InChIKey | LYANPDPXJYXTPF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|