About [4-(aminomethyl)phenyl] phosphono hydrogen phosphate
[4-(aminomethyl)phenyl] phosphono hydrogen phosphate (PubChem CID 174820126) has the molecular formula C7H11NO7P2
and a molecular weight of 283.11 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl] phosphono hydrogen phosphate.
Molecular Properties
| Compound Name | [4-(aminomethyl)phenyl] phosphono hydrogen phosphate |
| PubChem CID | 174820126 |
| Molecular Formula | C7H11NO7P2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | [4-(aminomethyl)phenyl] phosphono hydrogen phosphate |
| SMILES | NCc1ccc(OP(=O)(O)OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C7H11NO7P2/c8-5-6-1-3-7(4-2-6)14-17(12,13)15-16(9,10)11/h1-4H,5,8H2,(H,12,13)(H2,9,10,11) |
| InChIKey | GJRWIKNEDNRMOI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(aminomethyl)phenyl] phosphono hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)phenyl] phosphono hydrogen phosphate?
The IUPAC name of [4-(aminomethyl)phenyl] phosphono hydrogen phosphate (CID 174820126) is [4-(aminomethyl)phenyl] phosphono hydrogen phosphate.
What is the SMILES notation for [4-(aminomethyl)phenyl] phosphono hydrogen phosphate?
The canonical SMILES for [4-(aminomethyl)phenyl] phosphono hydrogen phosphate is NCc1ccc(OP(=O)(O)OP(=O)(O)O)cc1.
What is the InChIKey of [4-(aminomethyl)phenyl] phosphono hydrogen phosphate?
The InChIKey is GJRWIKNEDNRMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO7P2/c8-5-6-1-3-7(4-2-6)14-17(12,13)15-16(9,10)11/h1-4H,5,8H2,(H,12,13)(H2,9,10,11).
What are the key properties of [4-(aminomethyl)phenyl] phosphono hydrogen phosphate?
[4-(aminomethyl)phenyl] phosphono hydrogen phosphate has a molecular weight of 283.11 g/mol, XLogP of 0.73, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)phenyl] phosphono hydrogen phosphate is sourced from PubChem (CID 174820126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).