About (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate
(4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate (PubChem CID 174820129) has the molecular formula C5H6ClN11O2
and a molecular weight of 287.63 g/mol. Its IUPAC name is (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate.
Molecular Properties
| Compound Name | (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate |
| PubChem CID | 174820129 |
| Molecular Formula | C5H6ClN11O2 |
| Molecular Weight | 287.63 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate |
| SMILES | [H]/N=N/C(=NN)Oc1nc(Cl)nc(OC(=NN)/N=N/[H])n1 |
| InChI | InChI=1S/C5H6ClN11O2/c6-1-11-2(18-4(14-7)15-8)13-3(12-1)19-5(16-9)17-10/h7,9H,8,10H2/b14-7+,15-4?,16-9+,17-5? |
| InChIKey | GJJHFBGYXLEFKJ-WGJAZLEUSA-N |
| XLogP | -0.20 |
| TPSA | 206.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.63 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate?
The IUPAC name of (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate (CID 174820129) is (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate.
What is the SMILES notation for (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate?
The canonical SMILES for (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate is [H]/N=N/C(=NN)Oc1nc(Cl)nc(OC(=NN)/N=N/[H])n1.
What is the InChIKey of (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate?
The InChIKey is GJJHFBGYXLEFKJ-WGJAZLEUSA-N. The full InChI is InChI=1S/C5H6ClN11O2/c6-1-11-2(18-4(14-7)15-8)13-3(12-1)19-5(16-9)17-10/h7,9H,8,10H2/b14-7+,15-4?,16-9+,17-5?.
What are the key properties of (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate?
(4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate has a molecular weight of 287.63 g/mol, XLogP of -0.20, 2 rotatable bonds, 4 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-6-formazan-3-yloxy-1,3,5-triazin-2-yl) N'-amino-N-iminocarbamimidate is sourced from PubChem (CID 174820129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).