C15H15N3O4 — CID 174820916
[2-ethoxy-3-methyl-4-(6-oxo-1H-1,3,5-triazin-2-yl)phenyl] prop-2-enoate (PubChem CID 174820916) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is [2-ethoxy-3-methyl-4-(6-oxo-1H-1,3,5-triazin-2-yl)phenyl] prop-2-enoate.
| Compound Name | [2-ethoxy-3-methyl-4-(6-oxo-1H-1,3,5-triazin-2-yl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174820916 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [2-ethoxy-3-methyl-4-(6-oxo-1H-1,3,5-triazin-2-yl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ncnc(=O)[nH]2)c(C)c1OCC |
| InChI | InChI=1S/C15H15N3O4/c1-4-12(19)22-11-7-6-10(9(3)13(11)21-5-2)14-16-8-17-15(20)18-14/h4,6-8H,1,5H2,2-3H3,(H,16,17,18,20) |
| InChIKey | OAKFFFAJBMGBOE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|