C27H32ClNO2 — CID 174821317
10-butyl-2-chloro-9H-acridine;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 174821317) has the molecular formula C27H32ClNO2 and a molecular weight of 438.01 g/mol. Its IUPAC name is 10-butyl-2-chloro-9H-acridine;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | 10-butyl-2-chloro-9H-acridine;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 174821317 |
| Molecular Formula | C27H32ClNO2 |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 10-butyl-2-chloro-9H-acridine;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC12CCC(C(=O)C1=O)C2(C)C.CCCCN1c2ccccc2Cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H18ClN.C10H14O2/c1-2-3-10-19-16-7-5-4-6-13(16)11-14-12-15(18)8-9-17(14)19;1-9(2)6-4-5-10(9,3)8(12)7(6)11/h4-9,12H,2-3,10-11H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | WJRUKARLFSPJCL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|