About dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one
dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one (PubChem CID 174821421) has the molecular formula C8H14O6
and a molecular weight of 206.19 g/mol. Its IUPAC name is dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one |
| PubChem CID | 174821421 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one |
| SMILES | CCC1COC(=O)O1.COC(=O)OC |
| InChI | InChI=1S/C5H8O3.C3H6O3/c1-2-4-3-7-5(6)8-4;1-5-3(4)6-2/h4H,2-3H2,1H3;1-2H3 |
| InChIKey | FFGBUEMXMPRGJC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one?
The IUPAC name of dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one (CID 174821421) is dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one.
What is the SMILES notation for dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one?
The canonical SMILES for dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one is CCC1COC(=O)O1.COC(=O)OC.
What is the InChIKey of dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one?
The InChIKey is FFGBUEMXMPRGJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.C3H6O3/c1-2-4-3-7-5(6)8-4;1-5-3(4)6-2/h4H,2-3H2,1H3;1-2H3.
What are the key properties of dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one?
dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one has a molecular weight of 206.19 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl carbonate;4-ethyl-1,3-dioxolan-2-one is sourced from PubChem (CID 174821421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).